C36H45N5O7S2 — CID 22730841
4-(8-azaspiro[4.5]decan-8-yl)-N-[4-[[6-[(2-hydroxyacetyl)amino]-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 22730841) has the molecular formula C36H45N5O7S2 and a molecular weight of 723.92 g/mol. Its IUPAC name is 4-(8-azaspiro[4.5]decan-8-yl)-N-[4-[[6-[(2-hydroxyacetyl)amino]-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-(8-azaspiro[4.5]decan-8-yl)-N-[4-[[6-[(2-hydroxyacetyl)amino]-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22730841 |
| Molecular Formula | C36H45N5O7S2 |
| Molecular Weight | 723.92 g/mol |
| Exact Mass | 723.28 |
| IUPAC Name | 4-(8-azaspiro[4.5]decan-8-yl)-N-[4-[[6-[(2-hydroxyacetyl)amino]-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | O=C(CO)NCCCCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCC4(CCCC4)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C36H45N5O7S2/c42-25-34(43)37-21-7-4-8-28(26-49-30-9-2-1-3-10-30)38-32-16-15-31(24-33(32)41(45)46)50(47,48)39-35(44)27-11-13-29(14-12-27)40-22-19-36(20-23-40)17-5-6-18-36/h1-3,9-16,24,28,38,42H,4-8,17-23,25-26H2,(H,37,43)(H,39,44) |
| InChIKey | VADJDZKDSJGOAE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 170.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.92 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|