C33H33FN4O6S2 — CID 155569283
4-(4-fluorophenyl)-N-[4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 155569283) has the molecular formula C33H33FN4O6S2 and a molecular weight of 664.78 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-(4-fluorophenyl)-N-[4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 155569283 |
| Molecular Formula | C33H33FN4O6S2 |
| Molecular Weight | 664.78 g/mol |
| Exact Mass | 664.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(N[C@H](CCN2CCOCC2)CSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C33H33FN4O6S2/c34-27-12-10-25(11-13-27)24-6-8-26(9-7-24)33(39)36-46(42,43)30-14-15-31(32(22-30)38(40)41)35-28(16-17-37-18-20-44-21-19-37)23-45-29-4-2-1-3-5-29/h1-15,22,28,35H,16-21,23H2,(H,36,39)/t28-/m1/s1 |
| InChIKey | MYJSNJIVDDYHMU-MUUNZHRXSA-N |
| XLogP | 5.81 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.78 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|