C34H33N5O6S3 — CID 22730485
4-(2-methyl-1,3-benzothiazol-5-yl)-N-[4-[(1-morpholin-4-yl-3-phenylsulfanylpropan-2-yl)amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 22730485) has the molecular formula C34H33N5O6S3 and a molecular weight of 703.87 g/mol. Its IUPAC name is 4-(2-methyl-1,3-benzothiazol-5-yl)-N-[4-[(1-morpholin-4-yl-3-phenylsulfanylpropan-2-yl)amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-(2-methyl-1,3-benzothiazol-5-yl)-N-[4-[(1-morpholin-4-yl-3-phenylsulfanylpropan-2-yl)amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22730485 |
| Molecular Formula | C34H33N5O6S3 |
| Molecular Weight | 703.87 g/mol |
| Exact Mass | 703.16 |
| IUPAC Name | 4-(2-methyl-1,3-benzothiazol-5-yl)-N-[4-[(1-morpholin-4-yl-3-phenylsulfanylpropan-2-yl)amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | Cc1nc2cc(-c3ccc(C(=O)NS(=O)(=O)c4ccc(NC(CSc5ccccc5)CN5CCOCC5)c([N+](=O)[O-])c4)cc3)ccc2s1 |
| InChI | InChI=1S/C34H33N5O6S3/c1-23-35-31-19-26(11-14-33(31)47-23)24-7-9-25(10-8-24)34(40)37-48(43,44)29-12-13-30(32(20-29)39(41)42)36-27(21-38-15-17-45-18-16-38)22-46-28-5-3-2-4-6-28/h2-14,19-20,27,36H,15-18,21-22H2,1H3,(H,37,40) |
| InChIKey | MEDZACATMHWJMJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.87 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|