C32H32FN3O6S2 — CID 22730133
4-(4-fluorophenyl)-N-[4-[[1-[(2-methylpropan-2-yl)oxy]-3-phenylsulfanylpropan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 22730133) has the molecular formula C32H32FN3O6S2 and a molecular weight of 637.76 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[4-[[1-[(2-methylpropan-2-yl)oxy]-3-phenylsulfanylpropan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-(4-fluorophenyl)-N-[4-[[1-[(2-methylpropan-2-yl)oxy]-3-phenylsulfanylpropan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22730133 |
| Molecular Formula | C32H32FN3O6S2 |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[4-[[1-[(2-methylpropan-2-yl)oxy]-3-phenylsulfanylpropan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | CC(C)(C)OCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(-c3ccc(F)cc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H32FN3O6S2/c1-32(2,3)42-20-26(21-43-27-7-5-4-6-8-27)34-29-18-17-28(19-30(29)36(38)39)44(40,41)35-31(37)24-11-9-22(10-12-24)23-13-15-25(33)16-14-23/h4-19,26,34H,20-21H2,1-3H3,(H,35,37) |
| InChIKey | HRGKCDFILQUAIT-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|