C30H29FN4O5S2 — CID 22730672
N-[4-[[3-(dimethylamino)-2-phenylsulfanylpropyl]amino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide (PubChem CID 22730672) has the molecular formula C30H29FN4O5S2 and a molecular weight of 608.72 g/mol. Its IUPAC name is N-[4-[[3-(dimethylamino)-2-phenylsulfanylpropyl]amino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide.
| Compound Name | N-[4-[[3-(dimethylamino)-2-phenylsulfanylpropyl]amino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 22730672 |
| Molecular Formula | C30H29FN4O5S2 |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | N-[4-[[3-(dimethylamino)-2-phenylsulfanylpropyl]amino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide |
| SMILES | CN(C)CC(CNc1ccc(S(=O)(=O)NC(=O)c2ccc(-c3ccc(F)cc3)cc2)cc1[N+](=O)[O-])Sc1ccccc1 |
| InChI | InChI=1S/C30H29FN4O5S2/c1-34(2)20-26(41-25-6-4-3-5-7-25)19-32-28-17-16-27(18-29(28)35(37)38)42(39,40)33-30(36)23-10-8-21(9-11-23)22-12-14-24(31)15-13-22/h3-18,26,32H,19-20H2,1-2H3,(H,33,36) |
| InChIKey | OXSJBRPXJNIJDF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|