C21H27N4O5PS — CID 175829771
N-[4-[[1-(dimethylamino)phosphinan-4-yl]methylamino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 175829771) has the molecular formula C21H27N4O5PS and a molecular weight of 478.51 g/mol. Its IUPAC name is N-[4-[[1-(dimethylamino)phosphinan-4-yl]methylamino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | N-[4-[[1-(dimethylamino)phosphinan-4-yl]methylamino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 175829771 |
| Molecular Formula | C21H27N4O5PS |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-[4-[[1-(dimethylamino)phosphinan-4-yl]methylamino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | CN(C)P1CCC(CNc2ccc(S(=O)(=O)NC(=O)c3ccccc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H27N4O5PS/c1-24(2)31-12-10-16(11-13-31)15-22-19-9-8-18(14-20(19)25(27)28)32(29,30)23-21(26)17-6-4-3-5-7-17/h3-9,14,16,22H,10-13,15H2,1-2H3,(H,23,26) |
| InChIKey | ODYCAEHWNGAZCR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|