C30H36BN5O9S — CID 142766414
[2-[[4-[4-[[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylcarbamoyl]phenyl]piperazin-1-yl]methyl]phenoxy]boronic acid (PubChem CID 142766414) has the molecular formula C30H36BN5O9S and a molecular weight of 653.52 g/mol. Its IUPAC name is [2-[[4-[4-[[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylcarbamoyl]phenyl]piperazin-1-yl]methyl]phenoxy]boronic acid.
| Compound Name | [2-[[4-[4-[[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylcarbamoyl]phenyl]piperazin-1-yl]methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 142766414 |
| Molecular Formula | C30H36BN5O9S |
| Molecular Weight | 653.52 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | [2-[[4-[4-[[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylcarbamoyl]phenyl]piperazin-1-yl]methyl]phenoxy]boronic acid |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2CCOCC2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3OB(O)O)CC2)cc1 |
| InChI | InChI=1S/C30H36BN5O9S/c37-30(33-46(42,43)26-9-10-27(28(19-26)36(40)41)32-20-22-11-17-44-18-12-22)23-5-7-25(8-6-23)35-15-13-34(14-16-35)21-24-3-1-2-4-29(24)45-31(38)39/h1-10,19,22,32,38-39H,11-18,20-21H2,(H,33,37) |
| InChIKey | VSACWLIQKQEHKD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 183.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|