C38H37N5O6S2 — CID 164571101
4-[4-[[2-(3-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 164571101) has the molecular formula C38H37N5O6S2 and a molecular weight of 723.88 g/mol. Its IUPAC name is 4-[4-[[2-(3-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(3-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 164571101 |
| Molecular Formula | C38H37N5O6S2 |
| Molecular Weight | 723.88 g/mol |
| Exact Mass | 723.22 |
| IUPAC Name | 4-[4-[[2-(3-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3cccc(O)c3)CC2)cc1 |
| InChI | InChI=1S/C38H37N5O6S2/c44-32-9-6-8-29(25-32)35-12-5-4-7-30(35)27-41-20-22-42(23-21-41)31-15-13-28(14-16-31)38(45)40-51(48,49)34-17-18-36(37(26-34)43(46)47)39-19-24-50-33-10-2-1-3-11-33/h1-18,25-26,39,44H,19-24,27H2,(H,40,45) |
| InChIKey | WVZDHJJUUBUUMT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 145.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.88 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|