C42H45N5O6S2 — CID 169271900
4-[4-[[4-(3-ethoxyphenyl)-2-ethylphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 169271900) has the molecular formula C42H45N5O6S2 and a molecular weight of 779.99 g/mol. Its IUPAC name is 4-[4-[[4-(3-ethoxyphenyl)-2-ethylphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[4-(3-ethoxyphenyl)-2-ethylphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 169271900 |
| Molecular Formula | C42H45N5O6S2 |
| Molecular Weight | 779.99 g/mol |
| Exact Mass | 779.28 |
| IUPAC Name | 4-[4-[[4-(3-ethoxyphenyl)-2-ethylphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | CCOc1cccc(-c2ccc(CN3CCN(c4ccc(C(=O)NS(=O)(=O)c5ccc(NCCSc6ccccc6)c([N+](=O)[O-])c5)cc4)CC3)c(CC)c2)c1 |
| InChI | InChI=1S/C42H45N5O6S2/c1-3-31-27-34(33-9-8-10-37(28-33)53-4-2)13-14-35(31)30-45-22-24-46(25-23-45)36-17-15-32(16-18-36)42(48)44-55(51,52)39-19-20-40(41(29-39)47(49)50)43-21-26-54-38-11-6-5-7-12-38/h5-20,27-29,43H,3-4,21-26,30H2,1-2H3,(H,44,48) |
| InChIKey | ONQUCANIQZUOBG-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.99 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|