C40H41N7O7S2 — CID 169271769
6-[4-[3-[2-(3-ethoxyphenyl)phenyl]propanoyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide (PubChem CID 169271769) has the molecular formula C40H41N7O7S2 and a molecular weight of 795.94 g/mol. Its IUPAC name is 6-[4-[3-[2-(3-ethoxyphenyl)phenyl]propanoyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide.
| Compound Name | 6-[4-[3-[2-(3-ethoxyphenyl)phenyl]propanoyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 169271769 |
| Molecular Formula | C40H41N7O7S2 |
| Molecular Weight | 795.94 g/mol |
| Exact Mass | 795.25 |
| IUPAC Name | 6-[4-[3-[2-(3-ethoxyphenyl)phenyl]propanoyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide |
| SMILES | CCOc1cccc(-c2ccccc2CCC(=O)N2CCN(c3ccc(C(=O)NS(=O)(=O)c4ccc(NCCSc5ccccc5)c([N+](=O)[O-])c4)nn3)CC2)c1 |
| InChI | InChI=1S/C40H41N7O7S2/c1-2-54-31-11-8-10-30(27-31)34-14-7-6-9-29(34)15-20-39(48)46-24-22-45(23-25-46)38-19-18-36(42-43-38)40(49)44-56(52,53)33-16-17-35(37(28-33)47(50)51)41-21-26-55-32-12-4-3-5-13-32/h3-14,16-19,27-28,41H,2,15,20-26H2,1H3,(H,44,49) |
| InChIKey | OELBOUWDXFJPEJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.94 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|