C40H43N7O6S2 — CID 169273025
6-[4-[[4-(3-ethoxyphenyl)-2-ethylphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide (PubChem CID 169273025) has the molecular formula C40H43N7O6S2 and a molecular weight of 781.96 g/mol. Its IUPAC name is 6-[4-[[4-(3-ethoxyphenyl)-2-ethylphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide.
| Compound Name | 6-[4-[[4-(3-ethoxyphenyl)-2-ethylphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 169273025 |
| Molecular Formula | C40H43N7O6S2 |
| Molecular Weight | 781.96 g/mol |
| Exact Mass | 781.27 |
| IUPAC Name | 6-[4-[[4-(3-ethoxyphenyl)-2-ethylphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide |
| SMILES | CCOc1cccc(-c2ccc(CN3CCN(c4ccc(C(=O)NS(=O)(=O)c5ccc(NCCSc6ccccc6)c([N+](=O)[O-])c5)nn4)CC3)c(CC)c2)c1 |
| InChI | InChI=1S/C40H43N7O6S2/c1-3-29-25-31(30-9-8-10-33(26-30)53-4-2)13-14-32(29)28-45-20-22-46(23-21-45)39-18-17-37(42-43-39)40(48)44-55(51,52)35-15-16-36(38(27-35)47(49)50)41-19-24-54-34-11-6-5-7-12-34/h5-18,25-27,41H,3-4,19-24,28H2,1-2H3,(H,44,48) |
| InChIKey | DZLJBXOEWPNOSQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.96 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|