C41H43N5O7S2 — CID 164571084
4-[4-[[4-(3-ethoxyphenyl)-2-methoxyphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 164571084) has the molecular formula C41H43N5O7S2 and a molecular weight of 781.96 g/mol. Its IUPAC name is 4-[4-[[4-(3-ethoxyphenyl)-2-methoxyphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[4-(3-ethoxyphenyl)-2-methoxyphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 164571084 |
| Molecular Formula | C41H43N5O7S2 |
| Molecular Weight | 781.96 g/mol |
| Exact Mass | 781.26 |
| IUPAC Name | 4-[4-[[4-(3-ethoxyphenyl)-2-methoxyphenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | CCOc1cccc(-c2ccc(CN3CCN(c4ccc(C(=O)NS(=O)(=O)c5ccc(NCCSc6ccccc6)c([N+](=O)[O-])c5)cc4)CC3)c(OC)c2)c1 |
| InChI | InChI=1S/C41H43N5O7S2/c1-3-53-35-9-7-8-31(26-35)32-12-13-33(40(27-32)52-2)29-44-21-23-45(24-22-44)34-16-14-30(15-17-34)41(47)43-55(50,51)37-18-19-38(39(28-37)46(48)49)42-20-25-54-36-10-5-4-6-11-36/h4-19,26-28,42H,3,20-25,29H2,1-2H3,(H,43,47) |
| InChIKey | PNXGPVATIIPHAC-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.96 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|