C39H36F3N5O5S2 — CID 67069335
N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-4-[4-[[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 67069335) has the molecular formula C39H36F3N5O5S2 and a molecular weight of 775.88 g/mol. Its IUPAC name is N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-4-[4-[[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-4-[4-[[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 67069335 |
| Molecular Formula | C39H36F3N5O5S2 |
| Molecular Weight | 775.88 g/mol |
| Exact Mass | 775.21 |
| IUPAC Name | N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-4-[4-[[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C39H36F3N5O5S2/c40-39(41,42)31-14-10-28(11-15-31)35-9-5-4-6-30(35)27-45-21-23-46(24-22-45)32-16-12-29(13-17-32)38(48)44-54(51,52)34-18-19-36(37(26-34)47(49)50)43-20-25-53-33-7-2-1-3-8-33/h1-19,26,43H,20-25,27H2,(H,44,48) |
| InChIKey | PTIGXVGIWTUCID-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.88 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|