C42H42ClN5O5S2 — CID 67069333
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-[[1-(phenylsulfanylmethyl)cyclopentyl]amino]phenyl]sulfonylbenzamide (PubChem CID 67069333) has the molecular formula C42H42ClN5O5S2 and a molecular weight of 796.42 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-[[1-(phenylsulfanylmethyl)cyclopentyl]amino]phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-[[1-(phenylsulfanylmethyl)cyclopentyl]amino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67069333 |
| Molecular Formula | C42H42ClN5O5S2 |
| Molecular Weight | 796.42 g/mol |
| Exact Mass | 795.23 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-[[1-(phenylsulfanylmethyl)cyclopentyl]amino]phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NC2(CSc3ccccc3)CCCC2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C42H42ClN5O5S2/c43-34-16-12-31(13-17-34)38-11-5-4-8-33(38)29-46-24-26-47(27-25-46)35-18-14-32(15-19-35)41(49)45-55(52,53)37-20-21-39(40(28-37)48(50)51)44-42(22-6-7-23-42)30-54-36-9-2-1-3-10-36/h1-5,8-21,28,44H,6-7,22-27,29-30H2,(H,45,49) |
| InChIKey | XQUZLDPLLHBBLA-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.42 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|