C40H36F3N7O4S2 — CID 67118581
3-nitro-4-(2-phenylsulfanylethylamino)-N-[7-[4-[[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide (PubChem CID 67118581) has the molecular formula C40H36F3N7O4S2 and a molecular weight of 799.90 g/mol. Its IUPAC name is 3-nitro-4-(2-phenylsulfanylethylamino)-N-[7-[4-[[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide.
| Compound Name | 3-nitro-4-(2-phenylsulfanylethylamino)-N-[7-[4-[[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67118581 |
| Molecular Formula | C40H36F3N7O4S2 |
| Molecular Weight | 799.90 g/mol |
| Exact Mass | 799.22 |
| IUPAC Name | 3-nitro-4-(2-phenylsulfanylethylamino)-N-[7-[4-[[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5ccccc5-c5ccc(C(F)(F)F)cc5)CC4)ccc23)ccc1NCCSc1ccccc1 |
| InChI | InChI=1S/C40H36F3N7O4S2/c41-40(42,43)30-12-10-28(11-13-30)34-9-5-4-6-29(34)26-48-19-21-49(22-20-48)31-14-16-35-37(24-31)45-27-46-39(35)47-56(53,54)33-15-17-36(38(25-33)50(51)52)44-18-23-55-32-7-2-1-3-8-32/h1-17,24-25,27,44H,18-23,26H2,(H,45,46,47) |
| InChIKey | ZVTWDRPTYSIOIS-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.90 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|