C44H43N9O4S2 — CID 66909792
4-[[(2R)-4-imidazol-1-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide (PubChem CID 66909792) has the molecular formula C44H43N9O4S2 and a molecular weight of 826.02 g/mol. Its IUPAC name is 4-[[(2R)-4-imidazol-1-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide.
| Compound Name | 4-[[(2R)-4-imidazol-1-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 66909792 |
| Molecular Formula | C44H43N9O4S2 |
| Molecular Weight | 826.02 g/mol |
| Exact Mass | 825.29 |
| IUPAC Name | 4-[[(2R)-4-imidazol-1-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5ccccc5-c5ccccc5)CC4)ccc23)ccc1N[C@H](CCn1ccnc1)CSc1ccccc1 |
| InChI | InChI=1S/C44H43N9O4S2/c54-53(55)43-28-38(16-18-41(43)48-35(19-21-51-22-20-45-32-51)30-58-37-12-5-2-6-13-37)59(56,57)49-44-40-17-15-36(27-42(40)46-31-47-44)52-25-23-50(24-26-52)29-34-11-7-8-14-39(34)33-9-3-1-4-10-33/h1-18,20,22,27-28,31-32,35,48H,19,21,23-26,29-30H2,(H,46,47,49)/t35-/m1/s1 |
| InChIKey | POGSXCPSDVOUBI-PGUFJCEWSA-N |
| XLogP | 8.19 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.02 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|