C38H35ClN8O4S2 — CID 66909670
N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-pyridin-4-ylsulfanylethylamino)benzenesulfonamide (PubChem CID 66909670) has the molecular formula C38H35ClN8O4S2 and a molecular weight of 767.34 g/mol. Its IUPAC name is N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-pyridin-4-ylsulfanylethylamino)benzenesulfonamide.
| Compound Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-pyridin-4-ylsulfanylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 66909670 |
| Molecular Formula | C38H35ClN8O4S2 |
| Molecular Weight | 767.34 g/mol |
| Exact Mass | 766.19 |
| IUPAC Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-pyridin-4-ylsulfanylethylamino)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5ccccc5-c5ccc(Cl)cc5)CC4)ccc23)ccc1NCCSc1ccncc1 |
| InChI | InChI=1S/C38H35ClN8O4S2/c39-29-7-5-27(6-8-29)33-4-2-1-3-28(33)25-45-18-20-46(21-19-45)30-9-11-34-36(23-30)42-26-43-38(34)44-53(50,51)32-10-12-35(37(24-32)47(48)49)41-17-22-52-31-13-15-40-16-14-31/h1-16,23-24,26,41H,17-22,25H2,(H,42,43,44) |
| InChIKey | CBEFBMVAQMRAMY-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 146.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.34 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|