C39H35Cl2N7O4S2 — CID 67118990
N-[7-[4-[[2-(3,4-dichlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-phenylsulfanylethylamino)benzenesulfonamide (PubChem CID 67118990) has the molecular formula C39H35Cl2N7O4S2 and a molecular weight of 800.79 g/mol. Its IUPAC name is N-[7-[4-[[2-(3,4-dichlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-phenylsulfanylethylamino)benzenesulfonamide.
| Compound Name | N-[7-[4-[[2-(3,4-dichlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-phenylsulfanylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 67118990 |
| Molecular Formula | C39H35Cl2N7O4S2 |
| Molecular Weight | 800.79 g/mol |
| Exact Mass | 799.16 |
| IUPAC Name | N-[7-[4-[[2-(3,4-dichlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-phenylsulfanylethylamino)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5ccccc5-c5ccc(Cl)c(Cl)c5)CC4)ccc23)ccc1NCCSc1ccccc1 |
| InChI | InChI=1S/C39H35Cl2N7O4S2/c40-34-14-10-27(22-35(34)41)32-9-5-4-6-28(32)25-46-17-19-47(20-18-46)29-11-13-33-37(23-29)43-26-44-39(33)45-54(51,52)31-12-15-36(38(24-31)48(49)50)42-16-21-53-30-7-2-1-3-8-30/h1-15,22-24,26,42H,16-21,25H2,(H,43,44,45) |
| InChIKey | IXALJULXAPKNDB-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.79 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|