C46H49N7O6S2 — CID 66909639
N-[7-[4-(2-morpholin-4-ylethoxy)-4-[(2-phenylphenyl)methyl]piperidin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-phenylsulfanylethylamino)benzenesulfonamide (PubChem CID 66909639) has the molecular formula C46H49N7O6S2 and a molecular weight of 860.08 g/mol. Its IUPAC name is N-[7-[4-(2-morpholin-4-ylethoxy)-4-[(2-phenylphenyl)methyl]piperidin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-phenylsulfanylethylamino)benzenesulfonamide.
| Compound Name | N-[7-[4-(2-morpholin-4-ylethoxy)-4-[(2-phenylphenyl)methyl]piperidin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-phenylsulfanylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 66909639 |
| Molecular Formula | C46H49N7O6S2 |
| Molecular Weight | 860.08 g/mol |
| Exact Mass | 859.32 |
| IUPAC Name | N-[7-[4-(2-morpholin-4-ylethoxy)-4-[(2-phenylphenyl)methyl]piperidin-1-yl]quinazolin-4-yl]-3-nitro-4-(2-phenylsulfanylethylamino)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncnc3cc(N4CCC(Cc5ccccc5-c5ccccc5)(OCCN5CCOCC5)CC4)ccc23)ccc1NCCSc1ccccc1 |
| InChI | InChI=1S/C46H49N7O6S2/c54-53(55)44-32-39(16-18-42(44)47-21-30-60-38-12-5-2-6-13-38)61(56,57)50-45-41-17-15-37(31-43(41)48-34-49-45)52-22-19-46(20-23-52,59-29-26-51-24-27-58-28-25-51)33-36-11-7-8-14-40(36)35-9-3-1-4-10-35/h1-18,31-32,34,47H,19-30,33H2,(H,48,49,50) |
| InChIKey | KQZZYFLJOGQFEL-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.08 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|