C44H44N6O5S2 — CID 67118813
N-[7-[4-methoxy-4-[(2-phenylphenyl)methyl]piperidin-1-yl]quinazolin-4-yl]-3-nitro-4-[(2-phenylsulfanylcyclopentyl)amino]benzenesulfonamide (PubChem CID 67118813) has the molecular formula C44H44N6O5S2 and a molecular weight of 801.01 g/mol. Its IUPAC name is N-[7-[4-methoxy-4-[(2-phenylphenyl)methyl]piperidin-1-yl]quinazolin-4-yl]-3-nitro-4-[(2-phenylsulfanylcyclopentyl)amino]benzenesulfonamide.
| Compound Name | N-[7-[4-methoxy-4-[(2-phenylphenyl)methyl]piperidin-1-yl]quinazolin-4-yl]-3-nitro-4-[(2-phenylsulfanylcyclopentyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 67118813 |
| Molecular Formula | C44H44N6O5S2 |
| Molecular Weight | 801.01 g/mol |
| Exact Mass | 800.28 |
| IUPAC Name | N-[7-[4-methoxy-4-[(2-phenylphenyl)methyl]piperidin-1-yl]quinazolin-4-yl]-3-nitro-4-[(2-phenylsulfanylcyclopentyl)amino]benzenesulfonamide |
| SMILES | COC1(Cc2ccccc2-c2ccccc2)CCN(c2ccc3c(NS(=O)(=O)c4ccc(NC5CCCC5Sc5ccccc5)c([N+](=O)[O-])c4)ncnc3c2)CC1 |
| InChI | InChI=1S/C44H44N6O5S2/c1-55-44(29-32-13-8-9-16-36(32)31-11-4-2-5-12-31)23-25-49(26-24-44)33-19-21-37-40(27-33)45-30-46-43(37)48-57(53,54)35-20-22-38(41(28-35)50(51)52)47-39-17-10-18-42(39)56-34-14-6-3-7-15-34/h2-9,11-16,19-22,27-28,30,39,42,47H,10,17-18,23-26,29H2,1H3,(H,45,46,48) |
| InChIKey | IMYWGLUPZKIKRG-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.01 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|