C37H39N7O5S — CID 66909482
4-(1-methylpiperidin-4-yl)oxy-3-nitro-N-[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide (PubChem CID 66909482) has the molecular formula C37H39N7O5S and a molecular weight of 693.83 g/mol. Its IUPAC name is 4-(1-methylpiperidin-4-yl)oxy-3-nitro-N-[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide.
| Compound Name | 4-(1-methylpiperidin-4-yl)oxy-3-nitro-N-[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 66909482 |
| Molecular Formula | C37H39N7O5S |
| Molecular Weight | 693.83 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | 4-(1-methylpiperidin-4-yl)oxy-3-nitro-N-[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
| SMILES | CN1CCC(Oc2ccc(S(=O)(=O)Nc3ncnc4cc(N5CCN(Cc6ccccc6-c6ccccc6)CC5)ccc34)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C37H39N7O5S/c1-41-17-15-30(16-18-41)49-36-14-12-31(24-35(36)44(45)46)50(47,48)40-37-33-13-11-29(23-34(33)38-26-39-37)43-21-19-42(20-22-43)25-28-9-5-6-10-32(28)27-7-3-2-4-8-27/h2-14,23-24,26,30H,15-22,25H2,1H3,(H,38,39,40) |
| InChIKey | JYFGSIZZIYZGMC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.83 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|