C36H39N5O6S — CID 67069492
N-[4-(1-methylpiperidin-4-yl)oxy-3-nitrophenyl]sulfonyl-4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzamide (PubChem CID 67069492) has the molecular formula C36H39N5O6S and a molecular weight of 669.80 g/mol. Its IUPAC name is N-[4-(1-methylpiperidin-4-yl)oxy-3-nitrophenyl]sulfonyl-4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzamide.
| Compound Name | N-[4-(1-methylpiperidin-4-yl)oxy-3-nitrophenyl]sulfonyl-4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 67069492 |
| Molecular Formula | C36H39N5O6S |
| Molecular Weight | 669.80 g/mol |
| Exact Mass | 669.26 |
| IUPAC Name | N-[4-(1-methylpiperidin-4-yl)oxy-3-nitrophenyl]sulfonyl-4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzamide |
| SMILES | CN1CCC(Oc2ccc(S(=O)(=O)NC(=O)c3ccc(N4CCN(Cc5ccccc5-c5ccccc5)CC4)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C36H39N5O6S/c1-38-19-17-31(18-20-38)47-35-16-15-32(25-34(35)41(43)44)48(45,46)37-36(42)28-11-13-30(14-12-28)40-23-21-39(22-24-40)26-29-9-5-6-10-33(29)27-7-3-2-4-8-27/h2-16,25,31H,17-24,26H2,1H3,(H,37,42) |
| InChIKey | MRMMYYPITOQGAT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|