C47H52N10O5S — CID 67118683
1,3-dimethyl-1-[2-(4-methylpiperazin-1-yl)-1-phenylethyl]-3-[2-nitro-4-[[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]sulfamoyl]phenyl]urea (PubChem CID 67118683) has the molecular formula C47H52N10O5S and a molecular weight of 869.07 g/mol. Its IUPAC name is 1,3-dimethyl-1-[2-(4-methylpiperazin-1-yl)-1-phenylethyl]-3-[2-nitro-4-[[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]sulfamoyl]phenyl]urea.
| Compound Name | 1,3-dimethyl-1-[2-(4-methylpiperazin-1-yl)-1-phenylethyl]-3-[2-nitro-4-[[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 67118683 |
| Molecular Formula | C47H52N10O5S |
| Molecular Weight | 869.07 g/mol |
| Exact Mass | 868.38 |
| IUPAC Name | 1,3-dimethyl-1-[2-(4-methylpiperazin-1-yl)-1-phenylethyl]-3-[2-nitro-4-[[7-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]sulfamoyl]phenyl]urea |
| SMILES | CN1CCN(CC(c2ccccc2)N(C)C(=O)N(C)c2ccc(S(=O)(=O)Nc3ncnc4cc(N5CCN(Cc6ccccc6-c6ccccc6)CC5)ccc34)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C47H52N10O5S/c1-51-22-24-55(25-23-51)33-45(36-14-8-5-9-15-36)53(3)47(58)52(2)43-21-19-39(31-44(43)57(59)60)63(61,62)50-46-41-20-18-38(30-42(41)48-34-49-46)56-28-26-54(27-29-56)32-37-16-10-11-17-40(37)35-12-6-4-7-13-35/h4-21,30-31,34,45H,22-29,32-33H2,1-3H3,(H,48,49,50) |
| InChIKey | FISGVCCDLODDKN-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.07 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|