C44H48N4O6S2 — CID 67069674
4-[4-methoxy-4-[(2-phenylphenyl)methyl]piperidin-1-yl]-N-[4-[[(2S)-4-methyl-1-phenylsulfanylpentan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 67069674) has the molecular formula C44H48N4O6S2 and a molecular weight of 793.02 g/mol. Its IUPAC name is 4-[4-methoxy-4-[(2-phenylphenyl)methyl]piperidin-1-yl]-N-[4-[[(2S)-4-methyl-1-phenylsulfanylpentan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-[4-methoxy-4-[(2-phenylphenyl)methyl]piperidin-1-yl]-N-[4-[[(2S)-4-methyl-1-phenylsulfanylpentan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67069674 |
| Molecular Formula | C44H48N4O6S2 |
| Molecular Weight | 793.02 g/mol |
| Exact Mass | 792.30 |
| IUPAC Name | 4-[4-methoxy-4-[(2-phenylphenyl)methyl]piperidin-1-yl]-N-[4-[[(2S)-4-methyl-1-phenylsulfanylpentan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | COC1(Cc2ccccc2-c2ccccc2)CCN(c2ccc(C(=O)NS(=O)(=O)c3ccc(N[C@H](CSc4ccccc4)CC(C)C)c([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C44H48N4O6S2/c1-32(2)28-36(31-55-38-15-8-5-9-16-38)45-41-23-22-39(29-42(41)48(50)51)56(52,53)46-43(49)34-18-20-37(21-19-34)47-26-24-44(54-3,25-27-47)30-35-14-10-11-17-40(35)33-12-6-4-7-13-33/h4-23,29,32,36,45H,24-28,30-31H2,1-3H3,(H,46,49)/t36-/m0/s1 |
| InChIKey | FBPNGFUNOCHSQN-BHVANESWSA-N |
| XLogP | 9.23 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.02 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|