C45H48N8O5S2 — CID 67118774
4-[(4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl)amino]-3-nitro-N-[7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide (PubChem CID 67118774) has the molecular formula C45H48N8O5S2 and a molecular weight of 845.06 g/mol. Its IUPAC name is 4-[(4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl)amino]-3-nitro-N-[7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide.
| Compound Name | 4-[(4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl)amino]-3-nitro-N-[7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67118774 |
| Molecular Formula | C45H48N8O5S2 |
| Molecular Weight | 845.06 g/mol |
| Exact Mass | 844.32 |
| IUPAC Name | 4-[(4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl)amino]-3-nitro-N-[7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5cccc(-c6ccccc6)c5)CC4)ccc23)ccc1NC(CCN1CCOCC1)CSc1ccccc1 |
| InChI | InChI=1S/C45H48N8O5S2/c54-53(55)44-30-40(15-17-42(44)48-37(18-19-50-24-26-58-27-25-50)32-59-39-12-5-2-6-13-39)60(56,57)49-45-41-16-14-38(29-43(41)46-33-47-45)52-22-20-51(21-23-52)31-34-8-7-11-36(28-34)35-9-3-1-4-10-35/h1-17,28-30,33,37,48H,18-27,31-32H2,(H,46,47,49) |
| InChIKey | YHOHBQKAEJYOQJ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.06 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|