C42H46N10O5S2 — CID 66909745
4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[(2-phenylpyrazol-3-yl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide (PubChem CID 66909745) has the molecular formula C42H46N10O5S2 and a molecular weight of 835.03 g/mol. Its IUPAC name is 4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[(2-phenylpyrazol-3-yl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide.
| Compound Name | 4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[(2-phenylpyrazol-3-yl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 66909745 |
| Molecular Formula | C42H46N10O5S2 |
| Molecular Weight | 835.03 g/mol |
| Exact Mass | 834.31 |
| IUPAC Name | 4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[(2-phenylpyrazol-3-yl)methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5ccnn5-c5ccccc5)CC4)ccc23)ccc1N[C@H](CCN1CCOCC1)CSc1ccccc1 |
| InChI | InChI=1S/C42H46N10O5S2/c53-52(54)41-28-37(12-14-39(41)46-32(16-18-48-23-25-57-26-24-48)30-58-36-9-5-2-6-10-36)59(55,56)47-42-38-13-11-34(27-40(38)43-31-44-42)50-21-19-49(20-22-50)29-35-15-17-45-51(35)33-7-3-1-4-8-33/h1-15,17,27-28,31-32,46H,16,18-26,29-30H2,(H,43,44,47)/t32-/m1/s1 |
| InChIKey | KYBNWOMYTXVGPL-JGCGQSQUSA-N |
| XLogP | 6.14 |
| TPSA | 163.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.03 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|