C31H30FN5O7S3 — CID 22730388
4-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 22730388) has the molecular formula C31H30FN5O7S3 and a molecular weight of 699.81 g/mol. Its IUPAC name is 4-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22730388 |
| Molecular Formula | C31H30FN5O7S3 |
| Molecular Weight | 699.81 g/mol |
| Exact Mass | 699.13 |
| IUPAC Name | 4-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(N2CCN(S(=O)(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C31H30FN5O7S3/c32-24-5-4-8-28(21-24)47(43,44)36-18-16-35(17-19-36)25-11-9-23(10-12-25)31(38)34-46(41,42)27-13-14-29(30(22-27)37(39)40)33-15-20-45-26-6-2-1-3-7-26/h1-14,21-22,33H,15-20H2,(H,34,38) |
| InChIKey | IMUNIDHWCAGUIC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.81 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|