C28H23FN4O6S2 — CID 53234693
2-fluoro-N-[4-[[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylcarbamoyl]phenyl]benzamide (PubChem CID 53234693) has the molecular formula C28H23FN4O6S2 and a molecular weight of 594.65 g/mol. Its IUPAC name is 2-fluoro-N-[4-[[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylcarbamoyl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 53234693 |
| Molecular Formula | C28H23FN4O6S2 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | 2-fluoro-N-[4-[[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylcarbamoyl]phenyl]benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(NC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C28H23FN4O6S2/c29-24-9-5-4-8-23(24)28(35)31-20-12-10-19(11-13-20)27(34)32-41(38,39)22-14-15-25(26(18-22)33(36)37)30-16-17-40-21-6-2-1-3-7-21/h1-15,18,30H,16-17H2,(H,31,35)(H,32,34) |
| InChIKey | XTYVWLNNUKIEBG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|