C30H23ClN4O5S2 — CID 22730498
4-(2-chloroquinolin-8-yl)-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 22730498) has the molecular formula C30H23ClN4O5S2 and a molecular weight of 619.12 g/mol. Its IUPAC name is 4-(2-chloroquinolin-8-yl)-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-(2-chloroquinolin-8-yl)-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22730498 |
| Molecular Formula | C30H23ClN4O5S2 |
| Molecular Weight | 619.12 g/mol |
| Exact Mass | 618.08 |
| IUPAC Name | 4-(2-chloroquinolin-8-yl)-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(-c2cccc3ccc(Cl)nc23)cc1 |
| InChI | InChI=1S/C30H23ClN4O5S2/c31-28-16-13-21-5-4-8-25(29(21)33-28)20-9-11-22(12-10-20)30(36)34-42(39,40)24-14-15-26(27(19-24)35(37)38)32-17-18-41-23-6-2-1-3-7-23/h1-16,19,32H,17-18H2,(H,34,36) |
| InChIKey | JNSUHYWBAKVALB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.12 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|