C31H33N5O5S2 — CID 22730263
4-[1-(cyclohexylmethyl)pyrazol-4-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 22730263) has the molecular formula C31H33N5O5S2 and a molecular weight of 619.77 g/mol. Its IUPAC name is 4-[1-(cyclohexylmethyl)pyrazol-4-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[1-(cyclohexylmethyl)pyrazol-4-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22730263 |
| Molecular Formula | C31H33N5O5S2 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | 4-[1-(cyclohexylmethyl)pyrazol-4-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(-c2cnn(CC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C31H33N5O5S2/c37-31(25-13-11-24(12-14-25)26-20-33-35(22-26)21-23-7-3-1-4-8-23)34-43(40,41)28-15-16-29(30(19-28)36(38)39)32-17-18-42-27-9-5-2-6-10-27/h2,5-6,9-16,19-20,22-23,32H,1,3-4,7-8,17-18,21H2,(H,34,37) |
| InChIKey | PXSFWCHIECLBAX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|