C39H43N5O5S2 — CID 22729987
4-[2-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 22729987) has the molecular formula C39H43N5O5S2 and a molecular weight of 725.94 g/mol. Its IUPAC name is 4-[2-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[2-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22729987 |
| Molecular Formula | C39H43N5O5S2 |
| Molecular Weight | 725.94 g/mol |
| Exact Mass | 725.27 |
| IUPAC Name | 4-[2-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | CCCCc1nc2cc(-c3ccc(C(=O)NS(=O)(=O)c4ccc(NCCSc5ccccc5)c([N+](=O)[O-])c4)cc3)ccc2n1CC1CCCCC1 |
| InChI | InChI=1S/C39H43N5O5S2/c1-2-3-14-38-41-35-25-31(19-22-36(35)43(38)27-28-10-6-4-7-11-28)29-15-17-30(18-16-29)39(45)42-51(48,49)33-20-21-34(37(26-33)44(46)47)40-23-24-50-32-12-8-5-9-13-32/h5,8-9,12-13,15-22,25-26,28,40H,2-4,6-7,10-11,14,23-24,27H2,1H3,(H,42,45) |
| InChIKey | NPJPOJXOHFORMN-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.94 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|