C36H36N6O6S3 — CID 22730346
4-[2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-1,3-benzothiazol-5-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 22730346) has the molecular formula C36H36N6O6S3 and a molecular weight of 744.92 g/mol. Its IUPAC name is 4-[2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-1,3-benzothiazol-5-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-1,3-benzothiazol-5-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22730346 |
| Molecular Formula | C36H36N6O6S3 |
| Molecular Weight | 744.92 g/mol |
| Exact Mass | 744.19 |
| IUPAC Name | 4-[2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-1,3-benzothiazol-5-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | CN1CCN(C(=O)CCc2nc3cc(-c4ccc(C(=O)NS(=O)(=O)c5ccc(NCCSc6ccccc6)c([N+](=O)[O-])c5)cc4)ccc3s2)CC1 |
| InChI | InChI=1S/C36H36N6O6S3/c1-40-18-20-41(21-19-40)35(43)16-15-34-38-31-23-27(11-14-33(31)50-34)25-7-9-26(10-8-25)36(44)39-51(47,48)29-12-13-30(32(24-29)42(45)46)37-17-22-49-28-5-3-2-4-6-28/h2-14,23-24,37H,15-22H2,1H3,(H,39,44) |
| InChIKey | XFSZQUAMKVHLIW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 154.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.92 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|