C33H34N4O5S2 — CID 22730785
N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonyl-4-(2-ethyl-1,3-benzothiazol-5-yl)benzamide (PubChem CID 22730785) has the molecular formula C33H34N4O5S2 and a molecular weight of 630.79 g/mol. Its IUPAC name is N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonyl-4-(2-ethyl-1,3-benzothiazol-5-yl)benzamide.
| Compound Name | N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonyl-4-(2-ethyl-1,3-benzothiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 22730785 |
| Molecular Formula | C33H34N4O5S2 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonyl-4-(2-ethyl-1,3-benzothiazol-5-yl)benzamide |
| SMILES | CCc1nc2cc(-c3ccc(C(=O)NS(=O)(=O)c4ccc(NCC56CC7CC(CC(C7)C5)C6)c([N+](=O)[O-])c4)cc3)ccc2s1 |
| InChI | InChI=1S/C33H34N4O5S2/c1-2-31-35-28-14-25(7-10-30(28)43-31)23-3-5-24(6-4-23)32(38)36-44(41,42)26-8-9-27(29(15-26)37(39)40)34-19-33-16-20-11-21(17-33)13-22(12-20)18-33/h3-10,14-15,20-22,34H,2,11-13,16-19H2,1H3,(H,36,38) |
| InChIKey | FDJOVIUOHARFQL-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|