C42H54N6O6S2 — CID 118588264
4-[4-(1-adamantylmethyl)piperazin-1-yl]-N-[4-[[(2R)-4-morpholin-4-yl-2-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 118588264) has the molecular formula C42H54N6O6S2 and a molecular weight of 803.06 g/mol. Its IUPAC name is 4-[4-(1-adamantylmethyl)piperazin-1-yl]-N-[4-[[(2R)-4-morpholin-4-yl-2-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-[4-(1-adamantylmethyl)piperazin-1-yl]-N-[4-[[(2R)-4-morpholin-4-yl-2-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 118588264 |
| Molecular Formula | C42H54N6O6S2 |
| Molecular Weight | 803.06 g/mol |
| Exact Mass | 802.35 |
| IUPAC Name | 4-[4-(1-adamantylmethyl)piperazin-1-yl]-N-[4-[[(2R)-4-morpholin-4-yl-2-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | C[C@@](CCN1CCOCC1)(Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(CC45CC6CC(CC(C6)C4)C5)CC3)cc2)cc1[N+](=O)[O-])Sc1ccccc1 |
| InChI | InChI=1S/C42H54N6O6S2/c1-41(55-36-5-3-2-4-6-36,13-14-45-19-21-54-22-20-45)43-38-12-11-37(26-39(38)48(50)51)56(52,53)44-40(49)34-7-9-35(10-8-34)47-17-15-46(16-18-47)30-42-27-31-23-32(28-42)25-33(24-31)29-42/h2-12,26,31-33,43H,13-25,27-30H2,1H3,(H,44,49)/t31?,32?,33?,41-,42?/m1/s1 |
| InChIKey | JLXXPKKIYDSDOE-UXUFEXEBSA-N |
| XLogP | 6.69 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.06 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|