C29H39N5O7S — CID 57474951
tert-butyl 4-[4-[[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonylcarbamoyl]phenyl]piperazine-1-carboxylate (PubChem CID 57474951) has the molecular formula C29H39N5O7S and a molecular weight of 601.73 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonylcarbamoyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonylcarbamoyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57474951 |
| Molecular Formula | C29H39N5O7S |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | tert-butyl 4-[4-[[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonylcarbamoyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(=O)NS(=O)(=O)c3ccc(NCC4CCCCC4)c([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C29H39N5O7S/c1-29(2,3)41-28(36)33-17-15-32(16-18-33)23-11-9-22(10-12-23)27(35)31-42(39,40)24-13-14-25(26(19-24)34(37)38)30-20-21-7-5-4-6-8-21/h9-14,19,21,30H,4-8,15-18,20H2,1-3H3,(H,31,35) |
| InChIKey | ZHSUCNXNTXYHFO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 151.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|