C36H42N6O9S — CID 163637661
tert-butyl 4-[4-[2-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylacetyl]-3-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)phenyl]piperazine-1-carboxylate (PubChem CID 163637661) has the molecular formula C36H42N6O9S and a molecular weight of 734.83 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylacetyl]-3-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylacetyl]-3-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163637661 |
| Molecular Formula | C36H42N6O9S |
| Molecular Weight | 734.83 g/mol |
| Exact Mass | 734.27 |
| IUPAC Name | tert-butyl 4-[4-[2-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylacetyl]-3-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(=O)CS(=O)(=O)c3ccc(NCC4CCOCC4)c([N+](=O)[O-])c3)c(Oc3cnc4[nH]ccc4c3)c2)CC1 |
| InChI | InChI=1S/C36H42N6O9S/c1-36(2,3)51-35(44)41-14-12-40(13-15-41)26-4-6-29(33(19-26)50-27-18-25-8-11-37-34(25)39-22-27)32(43)23-52(47,48)28-5-7-30(31(20-28)42(45)46)38-21-24-9-16-49-17-10-24/h4-8,11,18-20,22,24,38H,9-10,12-17,21,23H2,1-3H3,(H,37,39) |
| InChIKey | BCSJDIWLHABEQF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 186.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.83 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|