C43H42ClN7O7S — CID 56591166
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 56591166) has the molecular formula C43H42ClN7O7S and a molecular weight of 836.37 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 56591166 |
| Molecular Formula | C43H42ClN7O7S |
| Molecular Weight | 836.37 g/mol |
| Exact Mass | 835.26 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2CCOCC2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C43H42ClN7O7S/c44-33-7-5-30(6-8-33)37-4-2-1-3-32(37)28-49-17-19-50(20-18-49)34-9-11-38(41(24-34)58-35-23-31-13-16-45-42(31)47-27-35)43(52)48-59(55,56)36-10-12-39(40(25-36)51(53)54)46-26-29-14-21-57-22-15-29/h1-13,16,23-25,27,29,46H,14-15,17-22,26,28H2,(H,45,47)(H,48,52) |
| InChIKey | YLFDOJBSBXUPPK-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 172.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.37 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|