C46H49ClN6O9S — CID 67536915
[4-[5-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-2-[[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylcarbamoyl]phenoxy]phenyl]methyl-ethylcarbamic acid (PubChem CID 67536915) has the molecular formula C46H49ClN6O9S and a molecular weight of 897.45 g/mol. Its IUPAC name is [4-[5-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-2-[[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylcarbamoyl]phenoxy]phenyl]methyl-ethylcarbamic acid.
| Compound Name | [4-[5-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-2-[[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylcarbamoyl]phenoxy]phenyl]methyl-ethylcarbamic acid |
|---|---|
| PubChem CID | 67536915 |
| Molecular Formula | C46H49ClN6O9S |
| Molecular Weight | 897.45 g/mol |
| Exact Mass | 896.30 |
| IUPAC Name | [4-[5-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-2-[[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylcarbamoyl]phenoxy]phenyl]methyl-ethylcarbamic acid |
| SMILES | CCN(Cc1ccc(Oc2cc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)ccc2C(=O)NS(=O)(=O)c2ccc(NCC3CCOCC3)c([N+](=O)[O-])c2)cc1)C(=O)O |
| InChI | InChI=1S/C46H49ClN6O9S/c1-2-51(46(55)56)30-33-7-14-38(15-8-33)62-44-27-37(52-23-21-50(22-24-52)31-35-5-3-4-6-40(35)34-9-11-36(47)12-10-34)13-17-41(44)45(54)49-63(59,60)39-16-18-42(43(28-39)53(57)58)48-29-32-19-25-61-26-20-32/h3-18,27-28,32,48H,2,19-26,29-31H2,1H3,(H,49,54)(H,55,56) |
| InChIKey | GYIACGQQGUONCG-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 183.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.45 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|