C44H47ClN6O6S — CID 67226394
2-benzyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonylbenzamide (PubChem CID 67226394) has the molecular formula C44H47ClN6O6S and a molecular weight of 823.42 g/mol. Its IUPAC name is 2-benzyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 2-benzyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67226394 |
| Molecular Formula | C44H47ClN6O6S |
| Molecular Weight | 823.42 g/mol |
| Exact Mass | 822.30 |
| IUPAC Name | 2-benzyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCCN2CCOCC2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1Cc1ccccc1 |
| InChI | InChI=1S/C44H47ClN6O6S/c45-37-13-11-34(12-14-37)40-10-5-4-9-35(40)32-49-21-23-50(24-22-49)38-15-17-41(36(30-38)29-33-7-2-1-3-8-33)44(52)47-58(55,56)39-16-18-42(43(31-39)51(53)54)46-19-6-20-48-25-27-57-28-26-48/h1-5,7-18,30-31,46H,6,19-29,32H2,(H,47,52) |
| InChIKey | PZGDGDLBNWDMGL-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.42 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|