C44H42ClN5O7S — CID 131971777
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2H-pyran-4-ylmethylamino)phenyl]sulfonyl-2-(2-phenylethoxy)benzamide (PubChem CID 131971777) has the molecular formula C44H42ClN5O7S and a molecular weight of 820.37 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2H-pyran-4-ylmethylamino)phenyl]sulfonyl-2-(2-phenylethoxy)benzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2H-pyran-4-ylmethylamino)phenyl]sulfonyl-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 131971777 |
| Molecular Formula | C44H42ClN5O7S |
| Molecular Weight | 820.37 g/mol |
| Exact Mass | 819.25 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(2H-pyran-4-ylmethylamino)phenyl]sulfonyl-2-(2-phenylethoxy)benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2=CCOC=C2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1OCCc1ccccc1 |
| InChI | InChI=1S/C44H42ClN5O7S/c45-36-12-10-34(11-13-36)39-9-5-4-8-35(39)31-48-21-23-49(24-22-48)37-14-16-40(43(28-37)57-27-20-32-6-2-1-3-7-32)44(51)47-58(54,55)38-15-17-41(42(29-38)50(52)53)46-30-33-18-25-56-26-19-33/h1-19,25,28-29,46H,20-24,26-27,30-31H2,(H,47,51) |
| InChIKey | IIFPBWPBRKQZTI-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.37 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|