C43H44ClN5O6S — CID 53262524
2-benzyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide (PubChem CID 53262524) has the molecular formula C43H44ClN5O6S and a molecular weight of 794.37 g/mol. Its IUPAC name is 2-benzyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 2-benzyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 53262524 |
| Molecular Formula | C43H44ClN5O6S |
| Molecular Weight | 794.37 g/mol |
| Exact Mass | 793.27 |
| IUPAC Name | 2-benzyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2CCOCC2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1Cc1ccccc1 |
| InChI | InChI=1S/C43H44ClN5O6S/c44-36-12-10-33(11-13-36)39-9-5-4-8-34(39)30-47-20-22-48(23-21-47)37-14-16-40(35(27-37)26-31-6-2-1-3-7-31)43(50)46-56(53,54)38-15-17-41(42(28-38)49(51)52)45-29-32-18-24-55-25-19-32/h1-17,27-28,32,45H,18-26,29-30H2,(H,46,50) |
| InChIKey | KZJGBGFWWMCIPS-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.37 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|