C43H43Cl2N5O7S — CID 67424792
2-(2-chlorophenoxy)-4-[4-[1-[2-(4-chlorophenyl)phenyl]ethyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide (PubChem CID 67424792) has the molecular formula C43H43Cl2N5O7S and a molecular weight of 844.82 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-4-[4-[1-[2-(4-chlorophenyl)phenyl]ethyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 2-(2-chlorophenoxy)-4-[4-[1-[2-(4-chlorophenyl)phenyl]ethyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67424792 |
| Molecular Formula | C43H43Cl2N5O7S |
| Molecular Weight | 844.82 g/mol |
| Exact Mass | 843.23 |
| IUPAC Name | 2-(2-chlorophenoxy)-4-[4-[1-[2-(4-chlorophenyl)phenyl]ethyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
| SMILES | CC(c1ccccc1-c1ccc(Cl)cc1)N1CCN(c2ccc(C(=O)NS(=O)(=O)c3ccc(NCC4CCOCC4)c([N+](=O)[O-])c3)c(Oc3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C43H43Cl2N5O7S/c1-29(35-6-2-3-7-36(35)31-10-12-32(44)13-11-31)48-20-22-49(23-21-48)33-14-16-37(42(26-33)57-41-9-5-4-8-38(41)45)43(51)47-58(54,55)34-15-17-39(40(27-34)50(52)53)46-28-30-18-24-56-25-19-30/h2-17,26-27,29-30,46H,18-25,28H2,1H3,(H,47,51) |
| InChIKey | SREBAAOBARFNMD-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.82 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|