C43H48Cl2N6O6S — CID 67225635
2-(2-chlorophenoxy)-4-[4-[[2-(4-chlorophenyl)cyclohepten-1-yl]methyl]piperazin-1-yl]-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 67225635) has the molecular formula C43H48Cl2N6O6S and a molecular weight of 847.87 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-4-[4-[[2-(4-chlorophenyl)cyclohepten-1-yl]methyl]piperazin-1-yl]-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 2-(2-chlorophenoxy)-4-[4-[[2-(4-chlorophenyl)cyclohepten-1-yl]methyl]piperazin-1-yl]-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67225635 |
| Molecular Formula | C43H48Cl2N6O6S |
| Molecular Weight | 847.87 g/mol |
| Exact Mass | 846.27 |
| IUPAC Name | 2-(2-chlorophenoxy)-4-[4-[[2-(4-chlorophenyl)cyclohepten-1-yl]methyl]piperazin-1-yl]-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | CN1CCC(Nc2ccc(S(=O)(=O)NC(=O)c3ccc(N4CCN(CC5=C(c6ccc(Cl)cc6)CCCCC5)CC4)cc3Oc3ccccc3Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C43H48Cl2N6O6S/c1-48-21-19-33(20-22-48)46-39-18-16-35(28-40(39)51(53)54)58(55,56)47-43(52)37-17-15-34(27-42(37)57-41-10-6-5-9-38(41)45)50-25-23-49(24-26-50)29-31-7-3-2-4-8-36(31)30-11-13-32(44)14-12-30/h5-6,9-18,27-28,33,46H,2-4,7-8,19-26,29H2,1H3,(H,47,52) |
| InChIKey | SSVWKBPOQJTKBD-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.87 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|