C44H48ClN7O6S — CID 67225801
4-[4-[[2-(4-chlorophenyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-4-yloxy)-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 67225801) has the molecular formula C44H48ClN7O6S and a molecular weight of 838.43 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-4-yloxy)-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-4-yloxy)-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67225801 |
| Molecular Formula | C44H48ClN7O6S |
| Molecular Weight | 838.43 g/mol |
| Exact Mass | 837.31 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-4-yloxy)-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | CN1CCC(Nc2ccc(S(=O)(=O)NC(=O)c3ccc(N4CCN(CC5=C(c6ccc(Cl)cc6)CCCC5)CC4)cc3Oc3cccc4[nH]ccc34)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C44H48ClN7O6S/c1-49-21-18-33(19-22-49)47-40-16-14-35(28-41(40)52(54)55)59(56,57)48-44(53)38-15-13-34(27-43(38)58-42-8-4-7-39-37(42)17-20-46-39)51-25-23-50(24-26-51)29-31-5-2-3-6-36(31)30-9-11-32(45)12-10-30/h4,7-17,20,27-28,33,46-47H,2-3,5-6,18-19,21-26,29H2,1H3,(H,48,53) |
| InChIKey | FWBSYNQAEXSXIS-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 153.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.43 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|