C27H27N5O6S — CID 67433263
2-(1H-indol-4-yloxy)-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 67433263) has the molecular formula C27H27N5O6S and a molecular weight of 549.61 g/mol. Its IUPAC name is 2-(1H-indol-4-yloxy)-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 2-(1H-indol-4-yloxy)-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67433263 |
| Molecular Formula | C27H27N5O6S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 2-(1H-indol-4-yloxy)-N-[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | CN1CCC(Nc2ccc(S(=O)(=O)NC(=O)c3ccccc3Oc3cccc4[nH]ccc34)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H27N5O6S/c1-31-15-12-18(13-16-31)29-23-10-9-19(17-24(23)32(34)35)39(36,37)30-27(33)21-5-2-3-7-26(21)38-25-8-4-6-22-20(25)11-14-28-22/h2-11,14,17-18,28-29H,12-13,15-16H2,1H3,(H,30,33) |
| InChIKey | MFFHGBWHPUOGBG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|