C31H33N5O7S — CID 68635350
2-(1H-indol-4-yloxy)-N-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 68635350) has the molecular formula C31H33N5O7S and a molecular weight of 619.70 g/mol. Its IUPAC name is 2-(1H-indol-4-yloxy)-N-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 2-(1H-indol-4-yloxy)-N-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 68635350 |
| Molecular Formula | C31H33N5O7S |
| Molecular Weight | 619.70 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | 2-(1H-indol-4-yloxy)-N-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NC2CCC(N3CCOCC3)CC2)c([N+](=O)[O-])c1)c1ccccc1Oc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C31H33N5O7S/c37-31(25-4-1-2-6-30(25)43-29-7-3-5-26-24(29)14-15-32-26)34-44(40,41)23-12-13-27(28(20-23)36(38)39)33-21-8-10-22(11-9-21)35-16-18-42-19-17-35/h1-7,12-15,20-22,32-33H,8-11,16-19H2,(H,34,37) |
| InChIKey | QZTXYLOZJHYGRF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|