C31H31F2N5O7S — CID 154118980
2-[(6,7-difluoro-1H-indol-5-yl)oxy]-N-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 154118980) has the molecular formula C31H31F2N5O7S and a molecular weight of 655.68 g/mol. Its IUPAC name is 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-N-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-N-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 154118980 |
| Molecular Formula | C31H31F2N5O7S |
| Molecular Weight | 655.68 g/mol |
| Exact Mass | 655.19 |
| IUPAC Name | 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-N-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NC2CCC(N3CCOCC3)CC2)c([N+](=O)[O-])c1)c1ccccc1Oc1cc2cc[nH]c2c(F)c1F |
| InChI | InChI=1S/C31H31F2N5O7S/c32-28-27(17-19-11-12-34-30(19)29(28)33)45-26-4-2-1-3-23(26)31(39)36-46(42,43)22-9-10-24(25(18-22)38(40)41)35-20-5-7-21(8-6-20)37-13-15-44-16-14-37/h1-4,9-12,17-18,20-21,34-35H,5-8,13-16H2,(H,36,39) |
| InChIKey | PWJLVGVBQSFROP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|