C28H28N6O7S — CID 67513850
3-[3-nitro-4-[[1-(oxetan-3-yl)piperidin-4-yl]amino]phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 67513850) has the molecular formula C28H28N6O7S and a molecular weight of 592.63 g/mol. Its IUPAC name is 3-[3-nitro-4-[[1-(oxetan-3-yl)piperidin-4-yl]amino]phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | 3-[3-nitro-4-[[1-(oxetan-3-yl)piperidin-4-yl]amino]phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 67513850 |
| Molecular Formula | C28H28N6O7S |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 3-[3-nitro-4-[[1-(oxetan-3-yl)piperidin-4-yl]amino]phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | NC(=O)c1cccc(S(=O)(=O)c2ccc(NC3CCN(C4COC4)CC3)c([N+](=O)[O-])c2)c1Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C28H28N6O7S/c29-27(35)22-2-1-3-25(26(22)41-20-12-17-6-9-30-28(17)31-14-20)42(38,39)21-4-5-23(24(13-21)34(36)37)32-18-7-10-33(11-8-18)19-15-40-16-19/h1-6,9,12-14,18-19,32H,7-8,10-11,15-16H2,(H2,29,35)(H,30,31) |
| InChIKey | AEBWTUBCXDGVHE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 182.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|