C30H34N6O7S — CID 67194651
6-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 67194651) has the molecular formula C30H34N6O7S and a molecular weight of 622.70 g/mol. Its IUPAC name is 6-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 67194651 |
| Molecular Formula | C30H34N6O7S |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 6-[4-[(4-morpholin-4-ylcyclohexyl)amino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1C=CC=CC1(Oc1cnc2[nH]ccc2c1)S(=O)(=O)c1ccc(NC2CCC(N3CCOCC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H34N6O7S/c31-28(37)25-3-1-2-11-30(25,43-23-17-20-10-12-32-29(20)33-19-23)44(40,41)24-8-9-26(27(18-24)36(38)39)34-21-4-6-22(7-5-21)35-13-15-42-16-14-35/h1-3,8-12,17-19,21-22,25,34H,4-7,13-16H2,(H2,31,37)(H,32,33) |
| InChIKey | GLXXJESBUZNKEM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 182.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|