C24H24N6O8S2 — CID 67513991
6-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)amino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 67513991) has the molecular formula C24H24N6O8S2 and a molecular weight of 588.62 g/mol. Its IUPAC name is 6-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)amino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)amino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 67513991 |
| Molecular Formula | C24H24N6O8S2 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.11 |
| IUPAC Name | 6-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)amino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1C=CC=CC1(Oc1cnc2[nH]ccc2c1)S(=O)(=O)c1ccc(NN2CCS(=O)(=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H24N6O8S2/c25-22(31)19-3-1-2-7-24(19,38-17-13-16-6-8-26-23(16)27-15-17)40(36,37)18-4-5-20(21(14-18)30(32)33)28-29-9-11-39(34,35)12-10-29/h1-8,13-15,19,28H,9-12H2,(H2,25,31)(H,26,27) |
| InChIKey | FBVAXAWMLWDQRG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 207.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|